C15H25F3N6O — CID 111500723
2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111500723) has the molecular formula C15H25F3N6O and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111500723 |
| Molecular Formula | C15H25F3N6O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(/NCCCn1nc(C)cc1C)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C15H25F3N6O/c1-11-8-12(2)24(22-11)7-5-6-20-14(19-3)21-9-13(25)23(4)10-15(16,17)18/h8H,5-7,9-10H2,1-4H3,(H2,19,20,21) |
| InChIKey | VQZVJTPPDQSUPT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|