C16H27F3N6O — CID 111500731
2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111500731) has the molecular formula C16H27F3N6O and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111500731 |
| Molecular Formula | C16H27F3N6O |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C16H27F3N6O/c1-5-20-15(22-10-14(26)24(4)11-16(17,18)19)21-7-6-8-25-13(3)9-12(2)23-25/h9H,5-8,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | KWSITHNVOPPWGD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|