C18H30O2 — CID 11150143
4-[(3S,3aS,7aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,7,7a-hexahydroinden-5-yl]butan-2-one (PubChem CID 11150143) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-[(3S,3aS,7aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,7,7a-hexahydroinden-5-yl]butan-2-one.
| Compound Name | 4-[(3S,3aS,7aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,7,7a-hexahydroinden-5-yl]butan-2-one |
|---|---|
| PubChem CID | 11150143 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-[(3S,3aS,7aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,7,7a-hexahydroinden-5-yl]butan-2-one |
| SMILES | CC(=O)CCC1=CC[C@@H]2CC[C@H](OC(C)(C)C)[C@@]2(C)C1 |
| InChI | InChI=1S/C18H30O2/c1-13(19)6-7-14-8-9-15-10-11-16(18(15,5)12-14)20-17(2,3)4/h8,15-16H,6-7,9-12H2,1-5H3/t15-,16+,18+/m1/s1 |
| InChIKey | RXOPZONTKADGOP-RYRKJORJSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|