C14H26F3N5O2 — CID 111501461
2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111501461) has the molecular formula C14H26F3N5O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111501461 |
| Molecular Formula | C14H26F3N5O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H26F3N5O2/c1-13(2,3)20-10(23)8-21(5)12(18-4)19-7-11(24)22(6)9-14(15,16)17/h7-9H2,1-6H3,(H,18,19)(H,20,23) |
| InChIKey | MHLNDCJNOQMBBO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|