C22H28FIN4O2 — CID 111503666
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111503666) has the molecular formula C22H28FIN4O2 and a molecular weight of 526.39 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111503666 |
| Molecular Formula | C22H28FIN4O2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCCC2=O)cc1)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C22H27FN4O2.HI/c1-16(29-20-6-3-5-18(23)13-20)14-25-22(24-2)26-15-17-8-10-19(11-9-17)27-12-4-7-21(27)28;/h3,5-6,8-11,13,16H,4,7,12,14-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | COGRWUSBXVLPFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|