About 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid
2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid (PubChem CID 11150370) has the molecular formula C13H12F3NO3
and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid |
| PubChem CID | 11150370 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid |
| SMILES | O=C(O)CN(/C=C/C(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)11(18)6-7-17(9-12(19)20)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,19,20)/b7-6+ |
| InChIKey | GWYIPTHWSHVEHU-VOTSOKGWSA-N |
| XLogP | 2.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid?
The IUPAC name of 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid (CID 11150370) is 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid.
What is the SMILES notation for 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid?
The canonical SMILES for 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid is O=C(O)CN(/C=C/C(=O)C(F)(F)F)Cc1ccccc1.
What is the InChIKey of 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid?
The InChIKey is GWYIPTHWSHVEHU-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H12F3NO3/c14-13(15,16)11(18)6-7-17(9-12(19)20)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,19,20)/b7-6+.
What are the key properties of 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid?
2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid has a molecular weight of 287.24 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]acetic acid is sourced from PubChem (CID 11150370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).