About 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine
3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 11150467) has the molecular formula C6H6IN5O
and a molecular weight of 291.05 g/mol. Its IUPAC name is 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine |
| PubChem CID | 11150467 |
| Molecular Formula | C6H6IN5O |
| Molecular Weight | 291.05 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | COc1nc(N)nc2n[nH]c(I)c12 |
| InChI | InChI=1S/C6H6IN5O/c1-13-5-2-3(7)11-12-4(2)9-6(8)10-5/h1H3,(H3,8,9,10,11,12) |
| InChIKey | QKTOJCLKVFGMDI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.05 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine?
The IUPAC name of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine (CID 11150467) is 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine.
What is the SMILES notation for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine?
The canonical SMILES for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine is COc1nc(N)nc2n[nH]c(I)c12.
What is the InChIKey of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine?
The InChIKey is QKTOJCLKVFGMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IN5O/c1-13-5-2-3(7)11-12-4(2)9-6(8)10-5/h1H3,(H3,8,9,10,11,12).
What are the key properties of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine?
3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine has a molecular weight of 291.05 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidin-6-amine is sourced from PubChem (CID 11150467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).