C20H28N2O2 — CID 111505667
1-(4-hydroxy-2,2-dimethylbutyl)-3-(1-naphthalen-2-ylpropan-2-yl)urea (PubChem CID 111505667) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylbutyl)-3-(1-naphthalen-2-ylpropan-2-yl)urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-(1-naphthalen-2-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 111505667 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-(1-naphthalen-2-ylpropan-2-yl)urea |
| SMILES | CC(Cc1ccc2ccccc2c1)NC(=O)NCC(C)(C)CCO |
| InChI | InChI=1S/C20H28N2O2/c1-15(22-19(24)21-14-20(2,3)10-11-23)12-16-8-9-17-6-4-5-7-18(17)13-16/h4-9,13,15,23H,10-12,14H2,1-3H3,(H2,21,22,24) |
| InChIKey | PTCQDRWJTOUXKL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |