C19H29N3O2 — CID 111506107
1-(4-hydroxy-2,2-dimethylpentyl)-3-[3-(1H-indol-3-yl)propyl]urea (PubChem CID 111506107) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[3-(1H-indol-3-yl)propyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[3-(1H-indol-3-yl)propyl]urea |
|---|---|
| PubChem CID | 111506107 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[3-(1H-indol-3-yl)propyl]urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)NCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H29N3O2/c1-14(23)11-19(2,3)13-22-18(24)20-10-6-7-15-12-21-17-9-5-4-8-16(15)17/h4-5,8-9,12,14,21,23H,6-7,10-11,13H2,1-3H3,(H2,20,22,24) |
| InChIKey | UNUGQCRRIPPTMI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|