C15H21F2NOSi — CID 11150657
[(1R,4S)-5,5-difluoro-2-(4-methoxyphenyl)-2-azabicyclo[2.1.1]hexan-1-yl]-trimethylsilane (PubChem CID 11150657) has the molecular formula C15H21F2NOSi and a molecular weight of 297.42 g/mol. Its IUPAC name is [(1R,4S)-5,5-difluoro-2-(4-methoxyphenyl)-2-azabicyclo[2.1.1]hexan-1-yl]-trimethylsilane.
| Compound Name | [(1R,4S)-5,5-difluoro-2-(4-methoxyphenyl)-2-azabicyclo[2.1.1]hexan-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11150657 |
| Molecular Formula | C15H21F2NOSi |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(1R,4S)-5,5-difluoro-2-(4-methoxyphenyl)-2-azabicyclo[2.1.1]hexan-1-yl]-trimethylsilane |
| SMILES | COc1ccc(N2C[C@@H]3C[C@@]2([Si](C)(C)C)C3(F)F)cc1 |
| InChI | InChI=1S/C15H21F2NOSi/c1-19-13-7-5-12(6-8-13)18-10-11-9-14(18,15(11,16)17)20(2,3)4/h5-8,11H,9-10H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | QYSZNQGNAODVLA-SMDDNHRTSA-N |
| XLogP | 3.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|