C12H24N2O2S — CID 111507324
N-(4-hydroxy-2,2-dimethylpentyl)thiomorpholine-4-carboxamide (PubChem CID 111507324) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)thiomorpholine-4-carboxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 111507324 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)thiomorpholine-4-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)N1CCSCC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-10(15)8-12(2,3)9-13-11(16)14-4-6-17-7-5-14/h10,15H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | ZJMZEOPYSWKTBA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |