C15H13NO6 — CID 11150827
[(3aS,6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrol-3a-yl] acetate (PubChem CID 11150827) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is [(3aS,6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrol-3a-yl] acetate.
| Compound Name | [(3aS,6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrol-3a-yl] acetate |
|---|---|
| PubChem CID | 11150827 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [(3aS,6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrol-3a-yl] acetate |
| SMILES | CC(=O)O[C@@]12CC(=O)O[C@@H]1C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C15H13NO6/c1-9(17)22-15-7-11(18)21-12(15)13(19)16(14(15)20)8-10-5-3-2-4-6-10/h2-6,12H,7-8H2,1H3/t12-,15+/m1/s1 |
| InChIKey | SOZOBRDLLOBJNC-DOMZBBRYSA-N |
| XLogP | 0.17 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|