C14H21FO6 — CID 11150854
methyl (2S,3S,4aR,8aR)-7-fluoro-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate (PubChem CID 11150854) has the molecular formula C14H21FO6 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl (2S,3S,4aR,8aR)-7-fluoro-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl (2S,3S,4aR,8aR)-7-fluoro-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 11150854 |
| Molecular Formula | C14H21FO6 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl (2S,3S,4aR,8aR)-7-fluoro-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxine-7-carboxylate |
| SMILES | COC(=O)C1(F)C=C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2C1 |
| InChI | InChI=1S/C14H21FO6/c1-12(18-4)13(2,19-5)21-10-8-14(15,11(16)17-3)7-6-9(10)20-12/h6-7,9-10H,8H2,1-5H3/t9-,10-,12+,13+,14?/m1/s1 |
| InChIKey | LKHBZJMMTFDDEA-INCGHIRZSA-N |
| XLogP | 1.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|