About 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea
1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea (PubChem CID 111509226) has the molecular formula C10H19F3N2O2
and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea.
Molecular Properties
| Compound Name | 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea |
| PubChem CID | 111509226 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea |
| SMILES | CCC(C)C(O)CNC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-3-7(2)8(16)6-15-9(17)14-5-4-10(11,12)13/h7-8,16H,3-6H2,1-2H3,(H2,14,15,17) |
| InChIKey | RLAYNQYVYDSJEG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea?
The IUPAC name of 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea (CID 111509226) is 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea.
What is the SMILES notation for 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea?
The canonical SMILES for 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea is CCC(C)C(O)CNC(=O)NCCC(F)(F)F.
What is the InChIKey of 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea?
The InChIKey is RLAYNQYVYDSJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2/c1-3-7(2)8(16)6-15-9(17)14-5-4-10(11,12)13/h7-8,16H,3-6H2,1-2H3,(H2,14,15,17).
What are the key properties of 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea?
1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea has a molecular weight of 256.27 g/mol, XLogP of 1.64, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-3-methylpentyl)-3-(3,3,3-trifluoropropyl)urea is sourced from PubChem (CID 111509226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).