C15H20O7 — CID 11151092
2-O-[(1S,2S,3R)-2-ethoxycarbonyl-3-[(1S,3E)-1-hydroxyhexa-3,5-dienyl]cyclopropyl] 1-O-methyl oxalate (PubChem CID 11151092) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-O-[(1S,2S,3R)-2-ethoxycarbonyl-3-[(1S,3E)-1-hydroxyhexa-3,5-dienyl]cyclopropyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[(1S,2S,3R)-2-ethoxycarbonyl-3-[(1S,3E)-1-hydroxyhexa-3,5-dienyl]cyclopropyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 11151092 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-O-[(1S,2S,3R)-2-ethoxycarbonyl-3-[(1S,3E)-1-hydroxyhexa-3,5-dienyl]cyclopropyl] 1-O-methyl oxalate |
| SMILES | C=C/C=C/C[C@H](O)[C@@H]1[C@H](OC(=O)C(=O)OC)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C15H20O7/c1-4-6-7-8-9(16)10-11(13(17)21-5-2)12(10)22-15(19)14(18)20-3/h4,6-7,9-12,16H,1,5,8H2,2-3H3/b7-6+/t9-,10-,11-,12-/m0/s1 |
| InChIKey | OTVHSUBHLFVLBP-HIYAJRIUSA-N |
| XLogP | 0.37 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|