C16H29IN6O2 — CID 111511091
ethyl 1-[N'-methyl-N-[4-(1,2,4-triazol-4-yl)butyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111511091) has the molecular formula C16H29IN6O2 and a molecular weight of 464.35 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[4-(1,2,4-triazol-4-yl)butyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[4-(1,2,4-triazol-4-yl)butyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111511091 |
| Molecular Formula | C16H29IN6O2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[4-(1,2,4-triazol-4-yl)butyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCCCn2cnnc2)CC1.I |
| InChI | InChI=1S/C16H28N6O2.HI/c1-3-24-15(23)14-6-10-22(11-7-14)16(17-2)18-8-4-5-9-21-12-19-20-13-21;/h12-14H,3-11H2,1-2H3,(H,17,18);1H |
| InChIKey | FLTJMZOUVWDRPK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|