About 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride
3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride (PubChem CID 11151281) has the molecular formula C18H20ClNO2
and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride |
| PubChem CID | 11151281 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride |
| SMILES | COc1cc2c(cc1OC)/C(=C/c1cccnc1)CCC2.Cl |
| InChI | InChI=1S/C18H19NO2.ClH/c1-20-17-10-15-7-3-6-14(16(15)11-18(17)21-2)9-13-5-4-8-19-12-13;/h4-5,8-12H,3,6-7H2,1-2H3;1H/b14-9+; |
| InChIKey | SFYGAAOQUDTFED-KYIGKLDSSA-N |
| XLogP | 4.40 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride?
The IUPAC name of 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride (CID 11151281) is 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride.
What is the SMILES notation for 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride?
The canonical SMILES for 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride is COc1cc2c(cc1OC)/C(=C/c1cccnc1)CCC2.Cl.
What is the InChIKey of 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride?
The InChIKey is SFYGAAOQUDTFED-KYIGKLDSSA-N. The full InChI is InChI=1S/C18H19NO2.ClH/c1-20-17-10-15-7-3-6-14(16(15)11-18(17)21-2)9-13-5-4-8-19-12-13;/h4-5,8-12H,3,6-7H2,1-2H3;1H/b14-9+;.
What are the key properties of 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride?
3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride has a molecular weight of 317.82 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-(6,7-dimethoxy-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]pyridine;hydrochloride is sourced from PubChem (CID 11151281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).