C15H30IN7 — CID 111513663
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111513663) has the molecular formula C15H30IN7 and a molecular weight of 435.36 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513663 |
| Molecular Formula | C15H30IN7 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N/C)NCCCCn1cnnc1.I |
| InChI | InChI=1S/C15H29N7.HI/c1-3-22-10-6-7-14(22)11-18-15(16-2)17-8-4-5-9-21-12-19-20-13-21;/h12-14H,3-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | IOOHOVOBEDFATR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|