C19H23FN6S — CID 111513786
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(2-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111513786) has the molecular formula C19H23FN6S and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(2-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(2-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111513786 |
| Molecular Formula | C19H23FN6S |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(2-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccccc1F)NCc1cccs1 |
| InChI | InChI=1S/C19H23FN6S/c1-2-18-25-24-14-26(18)10-9-21-19(23-13-16-7-5-11-27-16)22-12-15-6-3-4-8-17(15)20/h3-8,11,14H,2,9-10,12-13H2,1H3,(H2,21,22,23) |
| InChIKey | DMCMOJYSZDIKSY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|