About N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide
N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide (PubChem CID 111514838) has the molecular formula C18H31N7O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
| PubChem CID | 111514838 |
| Molecular Formula | C18H31N7O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1cnnc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C18H31N7O2/c1-2-19-18(20-7-3-4-8-23-14-21-22-15-23)25-11-9-24(10-12-25)17(26)16-6-5-13-27-16/h14-16H,2-13H2,1H3,(H,19,20) |
| InChIKey | XNASNCBUYCVSHJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide?
The IUPAC name of N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide (CID 111514838) is N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide.
What is the SMILES notation for N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide?
The canonical SMILES for N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide is CCN/C(=N\CCCCn1cnnc1)N1CCN(C(=O)C2CCCO2)CC1.
What is the InChIKey of N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide?
The InChIKey is XNASNCBUYCVSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N7O2/c1-2-19-18(20-7-3-4-8-23-14-21-22-15-23)25-11-9-24(10-12-25)17(26)16-6-5-13-27-16/h14-16H,2-13H2,1H3,(H,19,20).
What are the key properties of N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide?
N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide has a molecular weight of 377.49 g/mol, XLogP of 0.35, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(oxolane-2-carbonyl)-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide is sourced from PubChem (CID 111514838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).