About 2,7-dibromo-9H-carbazole
2,7-dibromo-9H-carbazole (PubChem CID 11151503) has the molecular formula C12H7Br2N
and a molecular weight of 325.00 g/mol. Its IUPAC name is 2,7-dibromo-9H-carbazole.
Molecular Properties
| Compound Name | 2,7-dibromo-9H-carbazole |
| PubChem CID | 11151503 |
| Molecular Formula | C12H7Br2N |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.89 |
| IUPAC Name | 2,7-dibromo-9H-carbazole |
| SMILES | Brc1ccc2c(c1)[nH]c1cc(Br)ccc12 |
| InChI | InChI=1S/C12H7Br2N/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h1-6,15H |
| InChIKey | QPTWWBLGJZWRAV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,7-dibromo-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9H-carbazole?
The IUPAC name of 2,7-dibromo-9H-carbazole (CID 11151503) is 2,7-dibromo-9H-carbazole.
What is the SMILES notation for 2,7-dibromo-9H-carbazole?
The canonical SMILES for 2,7-dibromo-9H-carbazole is Brc1ccc2c(c1)[nH]c1cc(Br)ccc12.
What is the InChIKey of 2,7-dibromo-9H-carbazole?
The InChIKey is QPTWWBLGJZWRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Br2N/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h1-6,15H.
What are the key properties of 2,7-dibromo-9H-carbazole?
2,7-dibromo-9H-carbazole has a molecular weight of 325.00 g/mol, XLogP of 4.85, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9H-carbazole is sourced from PubChem (CID 11151503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).