C18H36IN7 — CID 111516056
2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111516056) has the molecular formula C18H36IN7 and a molecular weight of 477.44 g/mol. Its IUPAC name is 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516056 |
| Molecular Formula | C18H36IN7 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCCCC1)NCCCCn1cnnc1.I |
| InChI | InChI=1S/C18H35N7.HI/c1-2-19-18(20-10-5-8-14-25-16-22-23-17-25)21-11-9-15-24-12-6-3-4-7-13-24;/h16-17H,2-15H2,1H3,(H2,19,20,21);1H |
| InChIKey | FQPGLPLCKQFNOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|