C14H26O5Si2 — CID 11151673
methyl (1R,2R,3S,6R)-2,3-bis(trimethylsilyloxy)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate (PubChem CID 11151673) has the molecular formula C14H26O5Si2 and a molecular weight of 330.53 g/mol. Its IUPAC name is methyl (1R,2R,3S,6R)-2,3-bis(trimethylsilyloxy)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate.
| Compound Name | methyl (1R,2R,3S,6R)-2,3-bis(trimethylsilyloxy)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate |
|---|---|
| PubChem CID | 11151673 |
| Molecular Formula | C14H26O5Si2 |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl (1R,2R,3S,6R)-2,3-bis(trimethylsilyloxy)-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C)C=C[C@H]2O[C@H]2[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O5Si2/c1-16-13(15)14(19-21(5,6)7)9-8-10-11(17-10)12(14)18-20(2,3)4/h8-12H,1-7H3/t10-,11-,12-,14+/m1/s1 |
| InChIKey | PAELTUSPMMUERQ-BYNQJWBRSA-N |
| XLogP | 2.31 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|