About N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride
N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride (PubChem CID 11151770) has the molecular formula C16H29Cl2N3
and a molecular weight of 334.33 g/mol. Its IUPAC name is N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride |
| PubChem CID | 11151770 |
| Molecular Formula | C16H29Cl2N3 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(NCCCCCCN2CCCCC2)ccn1 |
| InChI | InChI=1S/C16H27N3.2ClH/c1(2-5-13-19-14-6-3-7-15-19)4-10-18-16-8-11-17-12-9-16;;/h8-9,11-12H,1-7,10,13-15H2,(H,17,18);2*1H |
| InChIKey | QRHHQLSMKNJRMQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride?
The IUPAC name of N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride (CID 11151770) is N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride.
What is the SMILES notation for N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride?
The canonical SMILES for N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride is Cl.Cl.c1cc(NCCCCCCN2CCCCC2)ccn1.
What is the InChIKey of N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride?
The InChIKey is QRHHQLSMKNJRMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3.2ClH/c1(2-5-13-19-14-6-3-7-15-19)4-10-18-16-8-11-17-12-9-16;;/h8-9,11-12H,1-7,10,13-15H2,(H,17,18);2*1H.
What are the key properties of N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride?
N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride has a molecular weight of 334.33 g/mol, XLogP of 4.38, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-piperidin-1-ylhexyl)pyridin-4-amine;dihydrochloride is sourced from PubChem (CID 11151770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).