C24H16O2 — CID 11151846
(4aZ,8aZ,12aZ,16aZ)-tetraphenylene-1,16-diol (PubChem CID 11151846) has the molecular formula C24H16O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-tetraphenylene-1,16-diol.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-tetraphenylene-1,16-diol |
|---|---|
| PubChem CID | 11151846 |
| Molecular Formula | C24H16O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-tetraphenylene-1,16-diol |
| SMILES | Oc1cccc2/c1=c1/c(O)ccc/c1=c1\cccc\c1=c1/cccc/c1=2 |
| InChI | InChI=1S/C24H16O2/c25-21-13-5-11-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20-12-6-14-22(26)24(20)23(19)21/h1-14,25-26H/b16-15-,19-17-,20-18-,24-23- |
| InChIKey | TWSJLMGJCDXAFC-VQEJRNSZSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |