C18H27FN6O — CID 111518649
1-ethyl-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine (PubChem CID 111518649) has the molecular formula C18H27FN6O and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-ethyl-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111518649 |
| Molecular Formula | C18H27FN6O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-ethyl-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCn1cnnc1)NC(C)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C18H27FN6O/c1-4-20-18(21-9-5-6-10-25-12-22-23-13-25)24-14(2)15-7-8-17(26-3)16(19)11-15/h7-8,11-14H,4-6,9-10H2,1-3H3,(H2,20,21,24) |
| InChIKey | KCBUBUQCSFEVTP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|