About 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine
1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine (PubChem CID 11151905) has the molecular formula C13H12F6N4
and a molecular weight of 338.26 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine |
| PubChem CID | 11151905 |
| Molecular Formula | C13H12F6N4 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine |
| SMILES | CCC/N=C(\NC#N)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F6N4/c1-2-3-21-11(22-7-20)23-10-5-8(12(14,15)16)4-9(6-10)13(17,18)19/h4-6H,2-3H2,1H3,(H2,21,22,23) |
| InChIKey | KXZHRYWJMOGYKQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine (CID 11151905) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine is CCC/N=C(\NC#N)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine?
The InChIKey is KXZHRYWJMOGYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F6N4/c1-2-3-21-11(22-7-20)23-10-5-8(12(14,15)16)4-9(6-10)13(17,18)19/h4-6H,2-3H2,1H3,(H2,21,22,23).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine?
1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine has a molecular weight of 338.26 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-cyano-2-propylguanidine is sourced from PubChem (CID 11151905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).