C17H33IN6O — CID 111519108
1-(3-cyclohexyloxypropyl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111519108) has the molecular formula C17H33IN6O and a molecular weight of 464.40 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519108 |
| Molecular Formula | C17H33IN6O |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1cnnc1)NCCCOC1CCCCC1.I |
| InChI | InChI=1S/C17H32N6O.HI/c1-18-17(19-10-5-6-12-23-14-21-22-15-23)20-11-7-13-24-16-8-3-2-4-9-16;/h14-16H,2-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | MNCPZWNEHLFGQK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|