C25H30FIN6O — CID 111519448
1-ethyl-3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111519448) has the molecular formula C25H30FIN6O and a molecular weight of 576.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519448 |
| Molecular Formula | C25H30FIN6O |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-ethyl-3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCCc1ccn(-c2ccc(F)cc2)n1.I |
| InChI | InChI=1S/C25H29FN6O.HI/c1-2-27-25(29-18-19-5-9-22(10-6-19)31-16-3-4-24(31)33)28-15-13-21-14-17-32(30-21)23-11-7-20(26)8-12-23;/h5-12,14,17H,2-4,13,15-16,18H2,1H3,(H2,27,28,29);1H |
| InChIKey | WTGBFKILXKVMMO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|