C9H13F3N2O2 — CID 111519681
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 111519681) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 111519681 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C9H13F3N2O2/c10-9(11,12)5-13-8(16)14-7-2-1-6(3-7)4-15/h1-2,6-7,15H,3-5H2,(H2,13,14,16)/t6-,7+/m0/s1 |
| InChIKey | OMGYGCLAYRJJJD-NKWVEPMBSA-N |
| XLogP | 0.78 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|