C15H23O — CID 11151972
CID 11151972 (PubChem CID 11151972) has the molecular formula C15H23O and a molecular weight of 219.35 g/mol.
| Compound Name | CID 11151972 |
|---|---|
| PubChem CID | 11151972 |
| Molecular Formula | C15H23O |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]1(O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C15H23O/c1-11(2)14-9-8-12(3)10-15(14,16)13-6-4-5-7-13/h4-7,11-12,14,16H,8-10H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | AKJUNBONMSXTSE-VHDGCEQUSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |