C17H28O5Si — CID 11151987
methyl (3aR,4S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 11151987) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is methyl (3aR,4S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3aR,4S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 11151987 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl (3aR,4S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1CC(CO[Si](C)(C)C(C)(C)C)=C[C@@H]2COC(=O)[C@H]21 |
| InChI | InChI=1S/C17H28O5Si/c1-17(2,3)23(5,6)22-9-11-7-12-10-21-16(19)14(12)13(8-11)15(18)20-4/h7,12-14H,8-10H2,1-6H3/t12-,13+,14-/m1/s1 |
| InChIKey | ZOKLKKFEILHMFN-HZSPNIEDSA-N |
| XLogP | 2.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|