C17H28O5Si — CID 11151988
(1aR,7aS,7bR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-1a,4,7a,7b-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-one (PubChem CID 11151988) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is (1aR,7aS,7bR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-1a,4,7a,7b-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-one.
| Compound Name | (1aR,7aS,7bR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-1a,4,7a,7b-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-one |
|---|---|
| PubChem CID | 11151988 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1aR,7aS,7bR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-1a,4,7a,7b-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-one |
| SMILES | CC1(C)OCC2=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]3O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C17H28O5Si/c1-16(2,3)23(6,7)20-9-10-11-8-19-17(4,5)22-13(11)15-14(21-15)12(10)18/h13-15H,8-9H2,1-7H3/t13-,14-,15+/m0/s1 |
| InChIKey | NFLUUHPAXLNCRA-SOUVJXGZSA-N |
| XLogP | 2.81 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|