C19H36O3Si — CID 11151992
2-[(1S,3R,5R)-5-methyl-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid (PubChem CID 11151992) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 2-[(1S,3R,5R)-5-methyl-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid.
| Compound Name | 2-[(1S,3R,5R)-5-methyl-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 11151992 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[(1S,3R,5R)-5-methyl-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid |
| SMILES | C=C1[C@H](CC(=O)O)C[C@@H](C)C[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-12(2)23(13(3)4,14(5)6)22-18-10-15(7)9-17(16(18)8)11-19(20)21/h12-15,17-18H,8-11H2,1-7H3,(H,20,21)/t15-,17+,18-/m1/s1 |
| InChIKey | YZIYPQWIPCNJRW-BPQIPLTHSA-N |
| XLogP | 5.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|