C20H26FNO2 — CID 111520537
7-bicyclo[4.1.0]heptanyl-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methanone (PubChem CID 111520537) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methanone.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 111520537 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1C2CCCCC21)N1CCC(C(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FNO2/c21-15-7-5-13(6-8-15)19(23)14-9-11-22(12-10-14)20(24)18-16-3-1-2-4-17(16)18/h5-8,14,16-19,23H,1-4,9-12H2 |
| InChIKey | QKSSPPDKQSLFNJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |