C19H22FIN4O2 — CID 111521588
1-[(5-cyano-2-fluorophenyl)methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111521588) has the molecular formula C19H22FIN4O2 and a molecular weight of 484.31 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111521588 |
| Molecular Formula | C19H22FIN4O2 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C#N)ccc1F)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C19H21FN4O2.HI/c1-22-19(24-12-15-8-13(10-21)4-7-17(15)20)23-11-14-5-6-16(25-2)9-18(14)26-3;/h4-9H,11-12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | BZTGPSDWYLALRO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|