C21H21N3O2 — CID 11152212
(1R,12R)-15-benzyl-7-hydroxy-1-methyl-3,14,16-triazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-13-one (PubChem CID 11152212) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (1R,12R)-15-benzyl-7-hydroxy-1-methyl-3,14,16-triazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-13-one.
| Compound Name | (1R,12R)-15-benzyl-7-hydroxy-1-methyl-3,14,16-triazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-13-one |
|---|---|
| PubChem CID | 11152212 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (1R,12R)-15-benzyl-7-hydroxy-1-methyl-3,14,16-triazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-13-one |
| SMILES | C[C@]12N[C@H](Cc3c1[nH]c1ccc(O)cc31)C(=O)NC2Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O2/c1-21-18(9-12-5-3-2-4-6-12)23-20(26)17(24-21)11-15-14-10-13(25)7-8-16(14)22-19(15)21/h2-8,10,17-18,22,24-25H,9,11H2,1H3,(H,23,26)/t17-,18?,21-/m1/s1 |
| InChIKey | LWZRAWBZTVTNMK-IIAQOEISSA-N |
| XLogP | 2.34 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |