C21H31N5O2S2 — CID 111523235
1-ethyl-2-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111523235) has the molecular formula C21H31N5O2S2 and a molecular weight of 449.65 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111523235 |
| Molecular Formula | C21H31N5O2S2 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-ethyl-2-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCC(C)C2)cc1)NCc1ncc(C)s1 |
| InChI | InChI=1S/C21H31N5O2S2/c1-4-22-21(25-14-20-23-12-17(3)29-20)24-13-18-7-9-19(10-8-18)30(27,28)26-11-5-6-16(2)15-26/h7-10,12,16H,4-6,11,13-15H2,1-3H3,(H2,22,24,25) |
| InChIKey | BBALLWQUKOFJLO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|