C19H16N2O3S — CID 11152366
(3aS,6aR)-1,3-dibenzyl-3a,6a-dihydrothieno[3,4-d]imidazole-2,4,6-trione (PubChem CID 11152366) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is (3aS,6aR)-1,3-dibenzyl-3a,6a-dihydrothieno[3,4-d]imidazole-2,4,6-trione.
| Compound Name | (3aS,6aR)-1,3-dibenzyl-3a,6a-dihydrothieno[3,4-d]imidazole-2,4,6-trione |
|---|---|
| PubChem CID | 11152366 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3aS,6aR)-1,3-dibenzyl-3a,6a-dihydrothieno[3,4-d]imidazole-2,4,6-trione |
| SMILES | O=C1SC(=O)[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H16N2O3S/c22-17-15-16(18(23)25-17)21(12-14-9-5-2-6-10-14)19(24)20(15)11-13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+ |
| InChIKey | KFOKSYWUOUMVBB-IYBDPMFKSA-N |
| XLogP | 2.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|