C13H25FNO7P — CID 11152504
(2S)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 11152504) has the molecular formula C13H25FNO7P and a molecular weight of 357.32 g/mol. Its IUPAC name is (2S)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 11152504 |
| Molecular Formula | C13H25FNO7P |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2S)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCOP(=O)(OCC)C(F)C[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H25FNO7P/c1-6-20-23(19,21-7-2)10(14)8-9(11(16)17)15-12(18)22-13(3,4)5/h9-10H,6-8H2,1-5H3,(H,15,18)(H,16,17)/t9-,10?/m0/s1 |
| InChIKey | YLYWVNMKCXCMBZ-RGURZIINSA-N |
| XLogP | 2.92 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|