C25H30N4O2 — CID 111525796
N-ethyl-3-(phenylmethoxymethyl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111525796) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-ethyl-3-(phenylmethoxymethyl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(phenylmethoxymethyl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111525796 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-ethyl-3-(phenylmethoxymethyl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C25H30N4O2/c1-2-26-25(27-16-23-15-24(31-28-23)22-11-7-4-8-12-22)29-14-13-21(17-29)19-30-18-20-9-5-3-6-10-20/h3-12,15,21H,2,13-14,16-19H2,1H3,(H,26,27) |
| InChIKey | XLKXZICYBVXBNJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|