C15H21NOS4 — CID 11152591
1'-(1,3-dithian-2-yl)spiro[1,3-dithiane-2,3'-3a,4,5,6-tetrahydroindole]-2'-one (PubChem CID 11152591) has the molecular formula C15H21NOS4 and a molecular weight of 359.61 g/mol. Its IUPAC name is 1'-(1,3-dithian-2-yl)spiro[1,3-dithiane-2,3'-3a,4,5,6-tetrahydroindole]-2'-one.
| Compound Name | 1'-(1,3-dithian-2-yl)spiro[1,3-dithiane-2,3'-3a,4,5,6-tetrahydroindole]-2'-one |
|---|---|
| PubChem CID | 11152591 |
| Molecular Formula | C15H21NOS4 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1'-(1,3-dithian-2-yl)spiro[1,3-dithiane-2,3'-3a,4,5,6-tetrahydroindole]-2'-one |
| SMILES | O=C1N(C2SCCCS2)C2=CCCCC2C12SCCCS2 |
| InChI | InChI=1S/C15H21NOS4/c17-13-15(20-9-4-10-21-15)11-5-1-2-6-12(11)16(13)14-18-7-3-8-19-14/h6,11,14H,1-5,7-10H2 |
| InChIKey | NYHNKTXHQRAAFK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |