C26H33N5O2 — CID 111526167
N-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111526167) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111526167 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | N-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCc1noc(-c2ccc(CCN/C(=N/C)N3CCC(COCc4ccccc4)C3)cc2)n1 |
| InChI | InChI=1S/C26H33N5O2/c1-3-24-29-25(33-30-24)23-11-9-20(10-12-23)13-15-28-26(27-2)31-16-14-22(17-31)19-32-18-21-7-5-4-6-8-21/h4-12,22H,3,13-19H2,1-2H3,(H,27,28) |
| InChIKey | GWDLYTULJHBJIW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|