C19H15N5O3 — CID 11152634
4-[4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-hydroxybut-3-yn-2-yl]phenol (PubChem CID 11152634) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-[4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-hydroxybut-3-yn-2-yl]phenol.
| Compound Name | 4-[4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-hydroxybut-3-yn-2-yl]phenol |
|---|---|
| PubChem CID | 11152634 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-hydroxybut-3-yn-2-yl]phenol |
| SMILES | CC(O)(C#Cc1cn2nc(-c3ccco3)nc2c(N)n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H15N5O3/c1-19(26,12-4-6-14(25)7-5-12)9-8-13-11-24-18(16(20)21-13)22-17(23-24)15-3-2-10-27-15/h2-7,10-11,25-26H,1H3,(H2,20,21) |
| InChIKey | QOWHZXHELQMBCT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|