About tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate
tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate (PubChem CID 11152689) has the molecular formula C16H18ClF3N2O2
and a molecular weight of 362.78 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate |
| PubChem CID | 11152689 |
| Molecular Formula | C16H18ClF3N2O2 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)N(CC(F)(F)F)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClF3N2O2/c1-10(14(23)24-15(2,3)4)22(9-16(18,19)20)12-6-5-11(8-21)13(17)7-12/h5-7,10H,9H2,1-4H3/t10-/m0/s1 |
| InChIKey | ASVHEXRLSRTVCE-JTQLQIEISA-N |
| XLogP | 4.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate?
The IUPAC name of tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate (CID 11152689) is tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate.
What is the SMILES notation for tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate?
The canonical SMILES for tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate is C[C@@H](C(=O)OC(C)(C)C)N(CC(F)(F)F)c1ccc(C#N)c(Cl)c1.
What is the InChIKey of tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate?
The InChIKey is ASVHEXRLSRTVCE-JTQLQIEISA-N. The full InChI is InChI=1S/C16H18ClF3N2O2/c1-10(14(23)24-15(2,3)4)22(9-16(18,19)20)12-6-5-11(8-21)13(17)7-12/h5-7,10H,9H2,1-4H3/t10-/m0/s1.
What are the key properties of tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate?
tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate has a molecular weight of 362.78 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]propanoate is sourced from PubChem (CID 11152689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).