C24H32N4O2S — CID 111527215
N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111527215) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111527215 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C24H32N4O2S/c1-2-25-24(26-14-23(29)27-12-9-22-21(16-27)10-13-31-22)28-11-8-20(15-28)18-30-17-19-6-4-3-5-7-19/h3-7,10,13,20H,2,8-9,11-12,14-18H2,1H3,(H,25,26) |
| InChIKey | NRPJRZRVAJQNOQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|