C24H32N2O — CID 11152739
(7R,9S)-7-[[(3S,4R)-3-methyl-4-(2-methylphenyl)piperidin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol (PubChem CID 11152739) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (7R,9S)-7-[[(3S,4R)-3-methyl-4-(2-methylphenyl)piperidin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol.
| Compound Name | (7R,9S)-7-[[(3S,4R)-3-methyl-4-(2-methylphenyl)piperidin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol |
|---|---|
| PubChem CID | 11152739 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (7R,9S)-7-[[(3S,4R)-3-methyl-4-(2-methylphenyl)piperidin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol |
| SMILES | Cc1ccccc1[C@@H]1CCN(C[C@@H]2CCc3cccnc3[C@@H](O)C2)C[C@H]1C |
| InChI | InChI=1S/C24H32N2O/c1-17-6-3-4-8-21(17)22-11-13-26(15-18(22)2)16-19-9-10-20-7-5-12-25-24(20)23(27)14-19/h3-8,12,18-19,22-23,27H,9-11,13-16H2,1-2H3/t18-,19-,22-,23+/m1/s1 |
| InChIKey | OASYXJZGABKMRD-NNLJWKLDSA-N |
| XLogP | 4.50 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |