C18H27BrIN5S — CID 111527776
1-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111527776) has the molecular formula C18H27BrIN5S and a molecular weight of 552.32 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111527776 |
| Molecular Formula | C18H27BrIN5S |
| Molecular Weight | 552.32 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(C)c1)NCC(C)(C)Sc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H26BrN5S.HI/c1-5-20-17(21-10-14-11-23-24(4)12-14)22-13-18(2,3)25-16-8-6-15(19)7-9-16;/h6-9,11-12H,5,10,13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | IQCFIPPCQGPRDN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|