C20H34N4OS — CID 111529143
2-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111529143) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111529143 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N(C)C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C20H34N4OS/c1-6-21-20(23-16-9-12-18(13-16)26-5)22-14-19(24(2)3)15-7-10-17(25-4)11-8-15/h7-8,10-11,16,18-19H,6,9,12-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | PYACHMNOYHJTKB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|