C26H42O — CID 11152921
2-[(1E,3E,5E,7E)-9-hexoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 11152921) has the molecular formula C26H42O and a molecular weight of 370.62 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9-hexoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9-hexoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 11152921 |
| Molecular Formula | C26H42O |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9-hexoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCCCCCOC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C26H42O/c1-7-8-9-10-20-27-21-18-23(3)14-11-13-22(2)16-17-25-24(4)15-12-19-26(25,5)6/h11,13-14,16-18H,7-10,12,15,19-21H2,1-6H3/b14-11+,17-16+,22-13+,23-18+ |
| InChIKey | FQWAEJMYRVTMNU-CRBJACJQSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|